C10H10F3N — CID 77131470
2-(2,3,5-trifluorophenyl)pyrrolidine (PubChem CID 77131470) has the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. Its IUPAC name is 2-(2,3,5-trifluorophenyl)pyrrolidine.
| Compound Name | 2-(2,3,5-trifluorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 77131470 |
| Molecular Formula | C10H10F3N |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 2-(2,3,5-trifluorophenyl)pyrrolidine |
| SMILES | Fc1cc(F)c(F)c(C2CCCN2)c1 |
| InChI | InChI=1S/C10H10F3N/c11-6-4-7(9-2-1-3-14-9)10(13)8(12)5-6/h4-5,9,14H,1-3H2 |
| InChIKey | JPHZSASVRMNOMF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|