C12H15F2NO2S — CID 117440261
2-(2,3-difluoro-5-methylsulfonylphenyl)piperidine (PubChem CID 117440261) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-(2,3-difluoro-5-methylsulfonylphenyl)piperidine.
| Compound Name | 2-(2,3-difluoro-5-methylsulfonylphenyl)piperidine |
|---|---|
| PubChem CID | 117440261 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(2,3-difluoro-5-methylsulfonylphenyl)piperidine |
| SMILES | CS(=O)(=O)c1cc(F)c(F)c(C2CCCCN2)c1 |
| InChI | InChI=1S/C12H15F2NO2S/c1-18(16,17)8-6-9(12(14)10(13)7-8)11-4-2-3-5-15-11/h6-7,11,15H,2-5H2,1H3 |
| InChIKey | HZYXLMDAKRCJJT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |