C10H9BrF3N — CID 117116819
2-(3-bromo-2,4,5-trifluorophenyl)pyrrolidine (PubChem CID 117116819) has the molecular formula C10H9BrF3N and a molecular weight of 280.09 g/mol. Its IUPAC name is 2-(3-bromo-2,4,5-trifluorophenyl)pyrrolidine.
| Compound Name | 2-(3-bromo-2,4,5-trifluorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 117116819 |
| Molecular Formula | C10H9BrF3N |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 2-(3-bromo-2,4,5-trifluorophenyl)pyrrolidine |
| SMILES | Fc1cc(C2CCCN2)c(F)c(Br)c1F |
| InChI | InChI=1S/C10H9BrF3N/c11-8-9(13)5(4-6(12)10(8)14)7-2-1-3-15-7/h4,7,15H,1-3H2 |
| InChIKey | HDTUMBIKXNGYBY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|