About (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine
(2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine (PubChem CID 66519564) has the molecular formula C13H15F2NO
and a molecular weight of 239.26 g/mol. Its IUPAC name is (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine.
Molecular Properties
| Compound Name | (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine |
| PubChem CID | 66519564 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine |
| SMILES | Fc1cc([C@H]2CCCN2)c2c(c1F)OCCC2 |
| InChI | InChI=1S/C13H15F2NO/c14-10-7-9(11-4-1-5-16-11)8-3-2-6-17-13(8)12(10)15/h7,11,16H,1-6H2/t11-/m1/s1 |
| InChIKey | SDEGMBQTRWMSSZ-LLVKDONJSA-N |
| XLogP | 2.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine?
The IUPAC name of (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine (CID 66519564) is (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine.
What is the SMILES notation for (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine?
The canonical SMILES for (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine is Fc1cc([C@H]2CCCN2)c2c(c1F)OCCC2.
What is the InChIKey of (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine?
The InChIKey is SDEGMBQTRWMSSZ-LLVKDONJSA-N. The full InChI is InChI=1S/C13H15F2NO/c14-10-7-9(11-4-1-5-16-11)8-3-2-6-17-13(8)12(10)15/h7,11,16H,1-6H2/t11-/m1/s1.
What are the key properties of (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine?
(2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine has a molecular weight of 239.26 g/mol, XLogP of 2.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(7,8-difluoro-3,4-dihydro-2H-chromen-5-yl)pyrrolidine is sourced from PubChem (CID 66519564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).