C11H14Cl3N — CID 171195657
(2R)-2-(2,4-dichlorophenyl)piperidine;hydrochloride (PubChem CID 171195657) has the molecular formula C11H14Cl3N and a molecular weight of 266.60 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenyl)piperidine;hydrochloride.
| Compound Name | (2R)-2-(2,4-dichlorophenyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 171195657 |
| Molecular Formula | C11H14Cl3N |
| Molecular Weight | 266.60 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenyl)piperidine;hydrochloride |
| SMILES | Cl.Clc1ccc([C@H]2CCCCN2)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2N.ClH/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;/h4-5,7,11,14H,1-3,6H2;1H/t11-;/m1./s1 |
| InChIKey | XPYYXLZTNCHKEL-RFVHGSKJSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |