C12H16Cl3N — CID 17389702
2-(2,4-dichlorophenyl)azepane;hydrochloride (PubChem CID 17389702) has the molecular formula C12H16Cl3N and a molecular weight of 280.63 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)azepane;hydrochloride.
| Compound Name | 2-(2,4-dichlorophenyl)azepane;hydrochloride |
|---|---|
| PubChem CID | 17389702 |
| Molecular Formula | C12H16Cl3N |
| Molecular Weight | 280.63 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)azepane;hydrochloride |
| SMILES | Cl.Clc1ccc(C2CCCCCN2)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N.ClH/c13-9-5-6-10(11(14)8-9)12-4-2-1-3-7-15-12;/h5-6,8,12,15H,1-4,7H2;1H |
| InChIKey | QNOCTXCFENNUMM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |