C10H16N2O2 — CID 105449938
5-methoxy-4-methyl-2-piperidin-4-yl-1,3-oxazole (PubChem CID 105449938) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-methoxy-4-methyl-2-piperidin-4-yl-1,3-oxazole.
| Compound Name | 5-methoxy-4-methyl-2-piperidin-4-yl-1,3-oxazole |
|---|---|
| PubChem CID | 105449938 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 5-methoxy-4-methyl-2-piperidin-4-yl-1,3-oxazole |
| SMILES | COc1oc(C2CCNCC2)nc1C |
| InChI | InChI=1S/C10H16N2O2/c1-7-10(13-2)14-9(12-7)8-3-5-11-6-4-8/h8,11H,3-6H2,1-2H3 |
| InChIKey | UMAKRSZAJDMGLK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |