C11H16N2O2 — CID 105461830
2-(2-cyclopropyl-5-methyl-1,3-oxazol-4-yl)morpholine (PubChem CID 105461830) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(2-cyclopropyl-5-methyl-1,3-oxazol-4-yl)morpholine.
| Compound Name | 2-(2-cyclopropyl-5-methyl-1,3-oxazol-4-yl)morpholine |
|---|---|
| PubChem CID | 105461830 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-(2-cyclopropyl-5-methyl-1,3-oxazol-4-yl)morpholine |
| SMILES | Cc1oc(C2CC2)nc1C1CNCCO1 |
| InChI | InChI=1S/C11H16N2O2/c1-7-10(9-6-12-4-5-14-9)13-11(15-7)8-2-3-8/h8-9,12H,2-6H2,1H3 |
| InChIKey | MOAJUWONTJPYDR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |