C9H15N3O — CID 131585478
2-(1,4-dimethylpyrazol-3-yl)morpholine (PubChem CID 131585478) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-(1,4-dimethylpyrazol-3-yl)morpholine.
| Compound Name | 2-(1,4-dimethylpyrazol-3-yl)morpholine |
|---|---|
| PubChem CID | 131585478 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-(1,4-dimethylpyrazol-3-yl)morpholine |
| SMILES | Cc1cn(C)nc1C1CNCCO1 |
| InChI | InChI=1S/C9H15N3O/c1-7-6-12(2)11-9(7)8-5-10-3-4-13-8/h6,8,10H,3-5H2,1-2H3 |
| InChIKey | BKJZFSZZMGJXGL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |