C7H12N4O — CID 94552518
(2R)-2-(4-methyl-1,2,4-triazol-3-yl)morpholine (PubChem CID 94552518) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is (2R)-2-(4-methyl-1,2,4-triazol-3-yl)morpholine.
| Compound Name | (2R)-2-(4-methyl-1,2,4-triazol-3-yl)morpholine |
|---|---|
| PubChem CID | 94552518 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (2R)-2-(4-methyl-1,2,4-triazol-3-yl)morpholine |
| SMILES | Cn1cnnc1[C@H]1CNCCO1 |
| InChI | InChI=1S/C7H12N4O/c1-11-5-9-10-7(11)6-4-8-2-3-12-6/h5-6,8H,2-4H2,1H3/t6-/m1/s1 |
| InChIKey | GFRCNEYVJKBKLH-ZCFIWIBFSA-N |
| XLogP | -0.52 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |