C11H13N3O — CID 96619015
2-piperidin-4-ylfuro[2,3-d]pyridazine (PubChem CID 96619015) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-piperidin-4-ylfuro[2,3-d]pyridazine.
| Compound Name | 2-piperidin-4-ylfuro[2,3-d]pyridazine |
|---|---|
| PubChem CID | 96619015 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-piperidin-4-ylfuro[2,3-d]pyridazine |
| SMILES | c1nncc2oc(C3CCNCC3)cc12 |
| InChI | InChI=1S/C11H13N3O/c1-3-12-4-2-8(1)10-5-9-6-13-14-7-11(9)15-10/h5-8,12H,1-4H2 |
| InChIKey | PKROYTVTMGDQMG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |