C12H12Cl2N2O — CID 94979289
4,6-dichloro-2-piperidin-4-yl-1,3-benzoxazole (PubChem CID 94979289) has the molecular formula C12H12Cl2N2O and a molecular weight of 271.15 g/mol. Its IUPAC name is 4,6-dichloro-2-piperidin-4-yl-1,3-benzoxazole.
| Compound Name | 4,6-dichloro-2-piperidin-4-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 94979289 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 4,6-dichloro-2-piperidin-4-yl-1,3-benzoxazole |
| SMILES | Clc1cc(Cl)c2nc(C3CCNCC3)oc2c1 |
| InChI | InChI=1S/C12H12Cl2N2O/c13-8-5-9(14)11-10(6-8)17-12(16-11)7-1-3-15-4-2-7/h5-7,15H,1-4H2 |
| InChIKey | BVBXMRXMACEELI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |