C15H14Cl2N4O — CID 136962762
7,9-dichloro-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one (PubChem CID 136962762) has the molecular formula C15H14Cl2N4O and a molecular weight of 337.21 g/mol. Its IUPAC name is 7,9-dichloro-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one.
| Compound Name | 7,9-dichloro-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one |
|---|---|
| PubChem CID | 136962762 |
| Molecular Formula | C15H14Cl2N4O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 7,9-dichloro-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one |
| SMILES | O=c1cc(C2CCNCC2)n2nc3c(Cl)cc(Cl)cc3c2[nH]1 |
| InChI | InChI=1S/C15H14Cl2N4O/c16-9-5-10-14(11(17)6-9)20-21-12(7-13(22)19-15(10)21)8-1-3-18-4-2-8/h5-8,18H,1-4H2,(H,19,22) |
| InChIKey | SSHONGPABJSMOF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |