About 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane
10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane (PubChem CID 144841590) has the molecular formula C23H24F2N4O
and a molecular weight of 410.47 g/mol. Its IUPAC name is 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane.
Molecular Properties
| Compound Name | 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane |
| PubChem CID | 144841590 |
| Molecular Formula | C23H24F2N4O |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane |
| SMILES | CC.O=c1cc(C2CCNCC2)n2nc3cccc(-c4c(F)cccc4F)c3c2[nH]1 |
| InChI | InChI=1S/C21H18F2N4O.C2H6/c22-14-4-2-5-15(23)19(14)13-3-1-6-16-20(13)21-25-18(28)11-17(27(21)26-16)12-7-9-24-10-8-12;1-2/h1-6,11-12,24H,7-10H2,(H,25,28);1-2H3 |
| InChIKey | NNBBKPXDTOSKMH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane?
The IUPAC name of 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane (CID 144841590) is 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane.
What is the SMILES notation for 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane?
The canonical SMILES for 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane is CC.O=c1cc(C2CCNCC2)n2nc3cccc(-c4c(F)cccc4F)c3c2[nH]1.
What is the InChIKey of 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane?
The InChIKey is NNBBKPXDTOSKMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2N4O.C2H6/c22-14-4-2-5-15(23)19(14)13-3-1-6-16-20(13)21-25-18(28)11-17(27(21)26-16)12-7-9-24-10-8-12;1-2/h1-6,11-12,24H,7-10H2,(H,25,28);1-2H3.
What are the key properties of 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane?
10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane has a molecular weight of 410.47 g/mol, XLogP of 4.61, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2,6-difluorophenyl)-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one;ethane is sourced from PubChem (CID 144841590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).