C17H16N4O — CID 155544193
10-ethynyl-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one (PubChem CID 155544193) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 10-ethynyl-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one.
| Compound Name | 10-ethynyl-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one |
|---|---|
| PubChem CID | 155544193 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 10-ethynyl-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one |
| SMILES | C#Cc1cccc2nn3c(C4CCNCC4)cc(=O)[nH]c3c12 |
| InChI | InChI=1S/C17H16N4O/c1-2-11-4-3-5-13-16(11)17-19-15(22)10-14(21(17)20-13)12-6-8-18-9-7-12/h1,3-5,10,12,18H,6-9H2,(H,19,22) |
| InChIKey | SXLLSEZAJDPAAZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|