C17H17N7O — CID 136962724
4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one (PubChem CID 136962724) has the molecular formula C17H17N7O and a molecular weight of 335.37 g/mol. Its IUPAC name is 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one.
| Compound Name | 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one |
|---|---|
| PubChem CID | 136962724 |
| Molecular Formula | C17H17N7O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one |
| SMILES | O=c1cc(C2CCNCC2)n2nc3cccc(-n4ccnn4)c3c2[nH]1 |
| InChI | InChI=1S/C17H17N7O/c25-15-10-14(11-4-6-18-7-5-11)24-17(20-15)16-12(21-24)2-1-3-13(16)23-9-8-19-22-23/h1-3,8-11,18H,4-7H2,(H,20,25) |
| InChIKey | YDNXTICCLATOHH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |