C16H18N6O2 — CID 137053939
(2-oxo-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-10-yl)urea (PubChem CID 137053939) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is (2-oxo-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-10-yl)urea.
| Compound Name | (2-oxo-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-10-yl)urea |
|---|---|
| PubChem CID | 137053939 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (2-oxo-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-10-yl)urea |
| SMILES | NC(=O)Nc1cccc2nn3c(C4CCNCC4)cc(=O)[nH]c3c12 |
| InChI | InChI=1S/C16H18N6O2/c17-16(24)19-10-2-1-3-11-14(10)15-20-13(23)8-12(22(15)21-11)9-4-6-18-7-5-9/h1-3,8-9,18H,4-7H2,(H,20,23)(H3,17,19,24) |
| InChIKey | BPVZYXACKFJIPK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |