C21H29N7O2 — CID 137066414
1-[3-(dimethylamino)propyl]-3-(2-oxo-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-10-yl)urea (PubChem CID 137066414) has the molecular formula C21H29N7O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-(2-oxo-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-10-yl)urea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-(2-oxo-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-10-yl)urea |
|---|---|
| PubChem CID | 137066414 |
| Molecular Formula | C21H29N7O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-(2-oxo-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-10-yl)urea |
| SMILES | CN(C)CCCNC(=O)Nc1cccc2nn3c(C4CCNCC4)cc(=O)[nH]c3c12 |
| InChI | InChI=1S/C21H29N7O2/c1-27(2)12-4-9-23-21(30)24-15-5-3-6-16-19(15)20-25-18(29)13-17(28(20)26-16)14-7-10-22-11-8-14/h3,5-6,13-14,22H,4,7-12H2,1-2H3,(H,25,29)(H2,23,24,30) |
| InChIKey | FRFFJXCFMCIBKX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|