C21H24N4OS — CID 144841598
ethane;4-piperidin-4-yl-10-thiophen-3-yl-1H-pyrimido[1,2-b]indazol-2-one (PubChem CID 144841598) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is ethane;4-piperidin-4-yl-10-thiophen-3-yl-1H-pyrimido[1,2-b]indazol-2-one.
| Compound Name | ethane;4-piperidin-4-yl-10-thiophen-3-yl-1H-pyrimido[1,2-b]indazol-2-one |
|---|---|
| PubChem CID | 144841598 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | ethane;4-piperidin-4-yl-10-thiophen-3-yl-1H-pyrimido[1,2-b]indazol-2-one |
| SMILES | CC.O=c1cc(C2CCNCC2)n2nc3cccc(-c4ccsc4)c3c2[nH]1 |
| InChI | InChI=1S/C19H18N4OS.C2H6/c24-17-10-16(12-4-7-20-8-5-12)23-19(21-17)18-14(13-6-9-25-11-13)2-1-3-15(18)22-23;1-2/h1-3,6,9-12,20H,4-5,7-8H2,(H,21,24);1-2H3 |
| InChIKey | KOWYIEYHEDABFS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |