C21H19FN4O — CID 136962569
9-fluoro-10-phenyl-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one (PubChem CID 136962569) has the molecular formula C21H19FN4O and a molecular weight of 362.41 g/mol. Its IUPAC name is 9-fluoro-10-phenyl-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one.
| Compound Name | 9-fluoro-10-phenyl-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one |
|---|---|
| PubChem CID | 136962569 |
| Molecular Formula | C21H19FN4O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 9-fluoro-10-phenyl-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazol-2-one |
| SMILES | O=c1cc(C2CCNCC2)n2nc3ccc(F)c(-c4ccccc4)c3c2[nH]1 |
| InChI | InChI=1S/C21H19FN4O/c22-15-6-7-16-20(19(15)14-4-2-1-3-5-14)21-24-18(27)12-17(26(21)25-16)13-8-10-23-11-9-13/h1-7,12-13,23H,8-11H2,(H,24,27) |
| InChIKey | NORWSQPVXYFCFO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |