About 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride
4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride (PubChem CID 136962723) has the molecular formula C17H18ClN7O
and a molecular weight of 371.83 g/mol. Its IUPAC name is 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride.
Molecular Properties
| Compound Name | 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride |
| PubChem CID | 136962723 |
| Molecular Formula | C17H18ClN7O |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride |
| SMILES | Cl.O=c1cc(C2CCNCC2)n2nc3cccc(-n4ccnn4)c3c2[nH]1 |
| InChI | InChI=1S/C17H17N7O.ClH/c25-15-10-14(11-4-6-18-7-5-11)24-17(20-15)16-12(21-24)2-1-3-13(16)23-9-8-19-22-23;/h1-3,8-11,18H,4-7H2,(H,20,25);1H |
| InChIKey | YIISGPOQKJOKEP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride?
The IUPAC name of 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride (CID 136962723) is 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride.
What is the SMILES notation for 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride?
The canonical SMILES for 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride is Cl.O=c1cc(C2CCNCC2)n2nc3cccc(-n4ccnn4)c3c2[nH]1.
What is the InChIKey of 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride?
The InChIKey is YIISGPOQKJOKEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N7O.ClH/c25-15-10-14(11-4-6-18-7-5-11)24-17(20-15)16-12(21-24)2-1-3-13(16)23-9-8-19-22-23;/h1-3,8-11,18H,4-7H2,(H,20,25);1H.
What are the key properties of 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride?
4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride has a molecular weight of 371.83 g/mol, XLogP of 1.65, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-4-yl-10-(triazol-1-yl)-1H-pyrimido[1,2-b]indazol-2-one;hydrochloride is sourced from PubChem (CID 136962723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).