About 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine
3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine (PubChem CID 65184648) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine |
| PubChem CID | 65184648 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine |
| SMILES | COCCNCCCc1ncc(C2CCC2)o1 |
| InChI | InChI=1S/C13H22N2O2/c1-16-9-8-14-7-3-6-13-15-10-12(17-13)11-4-2-5-11/h10-11,14H,2-9H2,1H3 |
| InChIKey | JCKXAOPNJFCKED-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine?
The IUPAC name of 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine (CID 65184648) is 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine.
What is the SMILES notation for 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine?
The canonical SMILES for 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine is COCCNCCCc1ncc(C2CCC2)o1.
What is the InChIKey of 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine?
The InChIKey is JCKXAOPNJFCKED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-16-9-8-14-7-3-6-13-15-10-12(17-13)11-4-2-5-11/h10-11,14H,2-9H2,1H3.
What are the key properties of 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine?
3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine has a molecular weight of 238.33 g/mol, XLogP of 2.11, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-cyclobutyl-1,3-oxazol-2-yl)-N-(2-methoxyethyl)propan-1-amine is sourced from PubChem (CID 65184648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).