C12H18N2O2 — CID 115033401
4-(oxan-4-yl)-2-pyrrolidin-3-yl-1,3-oxazole (PubChem CID 115033401) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-(oxan-4-yl)-2-pyrrolidin-3-yl-1,3-oxazole.
| Compound Name | 4-(oxan-4-yl)-2-pyrrolidin-3-yl-1,3-oxazole |
|---|---|
| PubChem CID | 115033401 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-(oxan-4-yl)-2-pyrrolidin-3-yl-1,3-oxazole |
| SMILES | c1oc(C2CCNC2)nc1C1CCOCC1 |
| InChI | InChI=1S/C12H18N2O2/c1-4-13-7-10(1)12-14-11(8-16-12)9-2-5-15-6-3-9/h8-10,13H,1-7H2 |
| InChIKey | PLABKNUNCXRQPY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |