C9H15N3O — CID 115082091
2-(2-pyrrolidin-3-yl-1,3-oxazol-4-yl)ethanamine (PubChem CID 115082091) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-(2-pyrrolidin-3-yl-1,3-oxazol-4-yl)ethanamine.
| Compound Name | 2-(2-pyrrolidin-3-yl-1,3-oxazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 115082091 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-(2-pyrrolidin-3-yl-1,3-oxazol-4-yl)ethanamine |
| SMILES | NCCc1coc(C2CCNC2)n1 |
| InChI | InChI=1S/C9H15N3O/c10-3-1-8-6-13-9(12-8)7-2-4-11-5-7/h6-7,11H,1-5,10H2 |
| InChIKey | JXLDOENUNLMJIQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |