C9H12N2O2 — CID 115082035
2-(2-pyrrolidin-3-yl-1,3-oxazol-4-yl)acetaldehyde (PubChem CID 115082035) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-(2-pyrrolidin-3-yl-1,3-oxazol-4-yl)acetaldehyde.
| Compound Name | 2-(2-pyrrolidin-3-yl-1,3-oxazol-4-yl)acetaldehyde |
|---|---|
| PubChem CID | 115082035 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-(2-pyrrolidin-3-yl-1,3-oxazol-4-yl)acetaldehyde |
| SMILES | O=CCc1coc(C2CCNC2)n1 |
| InChI | InChI=1S/C9H12N2O2/c12-4-2-8-6-13-9(11-8)7-1-3-10-5-7/h4,6-7,10H,1-3,5H2 |
| InChIKey | GSEJRUINBQSRIC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|