C12H18N2OS — CID 115042771
2-piperidin-4-yl-4-(thiolan-2-yl)-1,3-oxazole (PubChem CID 115042771) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 2-piperidin-4-yl-4-(thiolan-2-yl)-1,3-oxazole.
| Compound Name | 2-piperidin-4-yl-4-(thiolan-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 115042771 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-piperidin-4-yl-4-(thiolan-2-yl)-1,3-oxazole |
| SMILES | c1oc(C2CCNCC2)nc1C1CCCS1 |
| InChI | InChI=1S/C12H18N2OS/c1-2-11(16-7-1)10-8-15-12(14-10)9-3-5-13-6-4-9/h8-9,11,13H,1-7H2 |
| InChIKey | XLSBNGHOKRKTDE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |