C11H16N2O3S — CID 115047857
4-[2-(azetidin-3-yl)-1,3-oxazol-4-yl]thiane 1,1-dioxide (PubChem CID 115047857) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-[2-(azetidin-3-yl)-1,3-oxazol-4-yl]thiane 1,1-dioxide.
| Compound Name | 4-[2-(azetidin-3-yl)-1,3-oxazol-4-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 115047857 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-[2-(azetidin-3-yl)-1,3-oxazol-4-yl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(c2coc(C3CNC3)n2)CC1 |
| InChI | InChI=1S/C11H16N2O3S/c14-17(15)3-1-8(2-4-17)10-7-16-11(13-10)9-5-12-6-9/h7-9,12H,1-6H2 |
| InChIKey | JULPLJYZFSQDDQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |