C10H15NO4S — CID 115045574
3-[4-(1,1-dioxothiolan-3-yl)-1,3-oxazol-2-yl]propan-1-ol (PubChem CID 115045574) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is 3-[4-(1,1-dioxothiolan-3-yl)-1,3-oxazol-2-yl]propan-1-ol.
| Compound Name | 3-[4-(1,1-dioxothiolan-3-yl)-1,3-oxazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 115045574 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-[4-(1,1-dioxothiolan-3-yl)-1,3-oxazol-2-yl]propan-1-ol |
| SMILES | O=S1(=O)CCC(c2coc(CCCO)n2)C1 |
| InChI | InChI=1S/C10H15NO4S/c12-4-1-2-10-11-9(6-15-10)8-3-5-16(13,14)7-8/h6,8,12H,1-5,7H2 |
| InChIKey | RUFOFOXFPQUMDZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |