C12H20N2O — CID 115026031
3-(4-cyclohexyl-1,3-oxazol-2-yl)propan-1-amine (PubChem CID 115026031) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-(4-cyclohexyl-1,3-oxazol-2-yl)propan-1-amine.
| Compound Name | 3-(4-cyclohexyl-1,3-oxazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 115026031 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 3-(4-cyclohexyl-1,3-oxazol-2-yl)propan-1-amine |
| SMILES | NCCCc1nc(C2CCCCC2)co1 |
| InChI | InChI=1S/C12H20N2O/c13-8-4-7-12-14-11(9-15-12)10-5-2-1-3-6-10/h9-10H,1-8,13H2 |
| InChIKey | ICADYZFBPGRFPI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |