About 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one
1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one (PubChem CID 68637080) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one |
| PubChem CID | 68637080 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one |
| SMILES | CC(=O)Cc1nc(C2CCCCC2)co1 |
| InChI | InChI=1S/C12H17NO2/c1-9(14)7-12-13-11(8-15-12)10-5-3-2-4-6-10/h8,10H,2-7H2,1H3 |
| InChIKey | NEESJHUTPHHVLC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one?
The IUPAC name of 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one (CID 68637080) is 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one.
What is the SMILES notation for 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one?
The canonical SMILES for 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one is CC(=O)Cc1nc(C2CCCCC2)co1.
What is the InChIKey of 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one?
The InChIKey is NEESJHUTPHHVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-9(14)7-12-13-11(8-15-12)10-5-3-2-4-6-10/h8,10H,2-7H2,1H3.
What are the key properties of 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one?
1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one has a molecular weight of 207.27 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-cyclohexyl-1,3-oxazol-2-yl)propan-2-one is sourced from PubChem (CID 68637080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).