C11H18N2O — CID 105422916
3-(4-cyclopentyl-1,2-oxazol-3-yl)propan-1-amine (PubChem CID 105422916) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-(4-cyclopentyl-1,2-oxazol-3-yl)propan-1-amine.
| Compound Name | 3-(4-cyclopentyl-1,2-oxazol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 105422916 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3-(4-cyclopentyl-1,2-oxazol-3-yl)propan-1-amine |
| SMILES | NCCCc1nocc1C1CCCC1 |
| InChI | InChI=1S/C11H18N2O/c12-7-3-6-11-10(8-14-13-11)9-4-1-2-5-9/h8-9H,1-7,12H2 |
| InChIKey | KKMMMKQBSVAUQO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |