C9H13NO4S — CID 115038257
[4-(1,1-dioxothian-2-yl)-1,3-oxazol-2-yl]methanol (PubChem CID 115038257) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is [4-(1,1-dioxothian-2-yl)-1,3-oxazol-2-yl]methanol.
| Compound Name | [4-(1,1-dioxothian-2-yl)-1,3-oxazol-2-yl]methanol |
|---|---|
| PubChem CID | 115038257 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | [4-(1,1-dioxothian-2-yl)-1,3-oxazol-2-yl]methanol |
| SMILES | O=S1(=O)CCCCC1c1coc(CO)n1 |
| InChI | InChI=1S/C9H13NO4S/c11-5-9-10-7(6-14-9)8-3-1-2-4-15(8,12)13/h6,8,11H,1-5H2 |
| InChIKey | MYSYPPCYCSQWPK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |