C9H13NO3S2 — CID 115090603
[2-(1,1-dioxothian-2-yl)-1,3-thiazol-5-yl]methanol (PubChem CID 115090603) has the molecular formula C9H13NO3S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is [2-(1,1-dioxothian-2-yl)-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-(1,1-dioxothian-2-yl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 115090603 |
| Molecular Formula | C9H13NO3S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | [2-(1,1-dioxothian-2-yl)-1,3-thiazol-5-yl]methanol |
| SMILES | O=S1(=O)CCCCC1c1ncc(CO)s1 |
| InChI | InChI=1S/C9H13NO3S2/c11-6-7-5-10-9(14-7)8-3-1-2-4-15(8,12)13/h5,8,11H,1-4,6H2 |
| InChIKey | AROAWUSYYGEEPV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |