C11H17NO3S2 — CID 115088486
1-[2-(1,1-dioxothian-2-yl)-1,3-thiazol-4-yl]propan-2-ol (PubChem CID 115088486) has the molecular formula C11H17NO3S2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-[2-(1,1-dioxothian-2-yl)-1,3-thiazol-4-yl]propan-2-ol.
| Compound Name | 1-[2-(1,1-dioxothian-2-yl)-1,3-thiazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 115088486 |
| Molecular Formula | C11H17NO3S2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 1-[2-(1,1-dioxothian-2-yl)-1,3-thiazol-4-yl]propan-2-ol |
| SMILES | CC(O)Cc1csc(C2CCCCS2(=O)=O)n1 |
| InChI | InChI=1S/C11H17NO3S2/c1-8(13)6-9-7-16-11(12-9)10-4-2-3-5-17(10,14)15/h7-8,10,13H,2-6H2,1H3 |
| InChIKey | FISDYSXDCJGRSP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |