C9H11NO3S2 — CID 115088374
2-[2-(1,1-dioxothiolan-2-yl)-1,3-thiazol-4-yl]acetaldehyde (PubChem CID 115088374) has the molecular formula C9H11NO3S2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-[2-(1,1-dioxothiolan-2-yl)-1,3-thiazol-4-yl]acetaldehyde.
| Compound Name | 2-[2-(1,1-dioxothiolan-2-yl)-1,3-thiazol-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 115088374 |
| Molecular Formula | C9H11NO3S2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 2-[2-(1,1-dioxothiolan-2-yl)-1,3-thiazol-4-yl]acetaldehyde |
| SMILES | O=CCc1csc(C2CCCS2(=O)=O)n1 |
| InChI | InChI=1S/C9H11NO3S2/c11-4-3-7-6-14-9(10-7)8-2-1-5-15(8,12)13/h4,6,8H,1-3,5H2 |
| InChIKey | CIPOJOOKNFVJQT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|