C8H9NO4S2 — CID 115046072
4-(1,1-dioxothiolan-2-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 115046072) has the molecular formula C8H9NO4S2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-2-yl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-(1,1-dioxothiolan-2-yl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115046072 |
| Molecular Formula | C8H9NO4S2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 4-(1,1-dioxothiolan-2-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1scnc1C1CCCS1(=O)=O |
| InChI | InChI=1S/C8H9NO4S2/c10-8(11)7-6(9-4-14-7)5-2-1-3-15(5,12)13/h4-5H,1-3H2,(H,10,11) |
| InChIKey | DYYWHHVJNADVQW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |