C14H20N2O3S2 — CID 75522417
4-cyclopentyl-N-(1,1-dioxothian-4-yl)-1,3-thiazole-5-carboxamide (PubChem CID 75522417) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-cyclopentyl-N-(1,1-dioxothian-4-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-cyclopentyl-N-(1,1-dioxothian-4-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 75522417 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-cyclopentyl-N-(1,1-dioxothian-4-yl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)CC1)c1scnc1C1CCCC1 |
| InChI | InChI=1S/C14H20N2O3S2/c17-14(16-11-5-7-21(18,19)8-6-11)13-12(15-9-20-13)10-3-1-2-4-10/h9-11H,1-8H2,(H,16,17) |
| InChIKey | VSFCHGCLDYWVLL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |