C14H15N3O2S — CID 166212697
4-cyclopentyl-N-(2-oxo-1-pyridinyl)-1,3-thiazole-5-carboxamide (PubChem CID 166212697) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-cyclopentyl-N-(2-oxo-1-pyridinyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-cyclopentyl-N-(2-oxo-1-pyridinyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 166212697 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-cyclopentyl-N-(2-oxo-1-pyridinyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nn1ccccc1=O)c1scnc1C1CCCC1 |
| InChI | InChI=1S/C14H15N3O2S/c18-11-7-3-4-8-17(11)16-14(19)13-12(15-9-20-13)10-5-1-2-6-10/h3-4,7-10H,1-2,5-6H2,(H,16,19) |
| InChIKey | NMJWTWLMULEVDF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |