C19H24N2O2S — CID 126773080
4-cyclopentyl-N-(2-ethoxy-2-phenylethyl)-1,3-thiazole-5-carboxamide (PubChem CID 126773080) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 4-cyclopentyl-N-(2-ethoxy-2-phenylethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-cyclopentyl-N-(2-ethoxy-2-phenylethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 126773080 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-cyclopentyl-N-(2-ethoxy-2-phenylethyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCOC(CNC(=O)c1scnc1C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-2-23-16(14-8-4-3-5-9-14)12-20-19(22)18-17(21-13-24-18)15-10-6-7-11-15/h3-5,8-9,13,15-16H,2,6-7,10-12H2,1H3,(H,20,22) |
| InChIKey | QHIFQSUJNGLXGT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |