C16H23BrN2O2 — CID 172583793
1-[2-(3-bromophenyl)-2-ethoxyethyl]-3-cyclopentylurea (PubChem CID 172583793) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is 1-[2-(3-bromophenyl)-2-ethoxyethyl]-3-cyclopentylurea.
| Compound Name | 1-[2-(3-bromophenyl)-2-ethoxyethyl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 172583793 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-[2-(3-bromophenyl)-2-ethoxyethyl]-3-cyclopentylurea |
| SMILES | CCOC(CNC(=O)NC1CCCC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H23BrN2O2/c1-2-21-15(12-6-5-7-13(17)10-12)11-18-16(20)19-14-8-3-4-9-14/h5-7,10,14-15H,2-4,8-9,11H2,1H3,(H2,18,19,20) |
| InChIKey | PCYJHQIXILLBBA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |