C14H18BrN3O2 — CID 3693189
1-[(3-bromobenzoyl)amino]-3-cyclohexylurea (PubChem CID 3693189) has the molecular formula C14H18BrN3O2 and a molecular weight of 340.22 g/mol. Its IUPAC name is 1-[(3-bromobenzoyl)amino]-3-cyclohexylurea.
| Compound Name | 1-[(3-bromobenzoyl)amino]-3-cyclohexylurea |
|---|---|
| PubChem CID | 3693189 |
| Molecular Formula | C14H18BrN3O2 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 1-[(3-bromobenzoyl)amino]-3-cyclohexylurea |
| SMILES | O=C(NNC(=O)c1cccc(Br)c1)NC1CCCCC1 |
| InChI | InChI=1S/C14H18BrN3O2/c15-11-6-4-5-10(9-11)13(19)17-18-14(20)16-12-7-2-1-3-8-12/h4-6,9,12H,1-3,7-8H2,(H,17,19)(H2,16,18,20) |
| InChIKey | UMAULKZIWACFDF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|