C17H19N3O2S — CID 75506058
N-[(3-carbamoylphenyl)methyl]-4-cyclopentyl-1,3-thiazole-5-carboxamide (PubChem CID 75506058) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is N-[(3-carbamoylphenyl)methyl]-4-cyclopentyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(3-carbamoylphenyl)methyl]-4-cyclopentyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 75506058 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[(3-carbamoylphenyl)methyl]-4-cyclopentyl-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1cccc(CNC(=O)c2scnc2C2CCCC2)c1 |
| InChI | InChI=1S/C17H19N3O2S/c18-16(21)13-7-3-4-11(8-13)9-19-17(22)15-14(20-10-23-15)12-5-1-2-6-12/h3-4,7-8,10,12H,1-2,5-6,9H2,(H2,18,21)(H,19,22) |
| InChIKey | FHDBPTFLXSJVIT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |