C8H9ClN2OS — CID 130735690
4-chloro-N-cyclobutyl-1,3-thiazole-5-carboxamide (PubChem CID 130735690) has the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. Its IUPAC name is 4-chloro-N-cyclobutyl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-chloro-N-cyclobutyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 130735690 |
| Molecular Formula | C8H9ClN2OS |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 4-chloro-N-cyclobutyl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NC1CCC1)c1scnc1Cl |
| InChI | InChI=1S/C8H9ClN2OS/c9-7-6(13-4-10-7)8(12)11-5-2-1-3-5/h4-5H,1-3H2,(H,11,12) |
| InChIKey | NUFHERCIXUIAHI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |