C12H17ClN2OS — CID 91821812
2-chloro-N-cycloheptyl-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 91821812) has the molecular formula C12H17ClN2OS and a molecular weight of 272.80 g/mol. Its IUPAC name is 2-chloro-N-cycloheptyl-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-chloro-N-cycloheptyl-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 91821812 |
| Molecular Formula | C12H17ClN2OS |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-chloro-N-cycloheptyl-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Cl)sc1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C12H17ClN2OS/c1-8-10(17-12(13)14-8)11(16)15-9-6-4-2-3-5-7-9/h9H,2-7H2,1H3,(H,15,16) |
| InChIKey | GUXWNJCVPBBBHA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |