About 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde
2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde (PubChem CID 115088243) has the molecular formula C10H13NO3S2
and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde |
| PubChem CID | 115088243 |
| Molecular Formula | C10H13NO3S2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde |
| SMILES | O=CCc1csc(C2CCCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C10H13NO3S2/c12-4-3-9-6-15-10(11-9)8-2-1-5-16(13,14)7-8/h4,6,8H,1-3,5,7H2 |
| InChIKey | JYFWIQCWHVENND-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde?
The IUPAC name of 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde (CID 115088243) is 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde.
What is the SMILES notation for 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde?
The canonical SMILES for 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde is O=CCc1csc(C2CCCS(=O)(=O)C2)n1.
What is the InChIKey of 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde?
The InChIKey is JYFWIQCWHVENND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3S2/c12-4-3-9-6-15-10(11-9)8-2-1-5-16(13,14)7-8/h4,6,8H,1-3,5,7H2.
What are the key properties of 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde?
2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde has a molecular weight of 259.35 g/mol, XLogP of 1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-4-yl]acetaldehyde is sourced from PubChem (CID 115088243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).