C11H15NOS — CID 116890297
4-(2-cyclobutyl-1,3-thiazol-4-yl)butan-2-one (PubChem CID 116890297) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 4-(2-cyclobutyl-1,3-thiazol-4-yl)butan-2-one.
| Compound Name | 4-(2-cyclobutyl-1,3-thiazol-4-yl)butan-2-one |
|---|---|
| PubChem CID | 116890297 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 4-(2-cyclobutyl-1,3-thiazol-4-yl)butan-2-one |
| SMILES | CC(=O)CCc1csc(C2CCC2)n1 |
| InChI | InChI=1S/C11H15NOS/c1-8(13)5-6-10-7-14-11(12-10)9-3-2-4-9/h7,9H,2-6H2,1H3 |
| InChIKey | LITJQWJELATJDF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |