C13H19NO2S — CID 116965847
4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 116965847) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 116965847 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | CCCc1csc(C2CCC(C(=O)O)CC2)n1 |
| InChI | InChI=1S/C13H19NO2S/c1-2-3-11-8-17-12(14-11)9-4-6-10(7-5-9)13(15)16/h8-10H,2-7H2,1H3,(H,15,16) |
| InChIKey | RXUUCROJRDALQO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |