4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid

C13H19NO2S — CID 116965847

IUPAC4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid
SMILESCCCc1csc(C2CCC(C(=O)O)CC2)n1
InChIInChI=1S/C13H19NO2S/c1-2-3-11-8-17-12(14-11)9-4-6-10(7-5-9)13(15)16/h8-10H,2-7H2,1H3,(H,15,16)
InChIKeyRXUUCROJRDALQO-UHFFFAOYSA-N
MW253.37 g/mol
LogP3.45
Rot. Bonds4

About 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid

4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 116965847) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid
PubChem CID116965847
Molecular FormulaC13H19NO2S
Molecular Weight253.37 g/mol
Exact Mass253.11
IUPAC Name4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid
SMILESCCCc1csc(C2CCC(C(=O)O)CC2)n1
InChIInChI=1S/C13H19NO2S/c1-2-3-11-8-17-12(14-11)9-4-6-10(7-5-9)13(15)16/h8-10H,2-7H2,1H3,(H,15,16)
InChIKeyRXUUCROJRDALQO-UHFFFAOYSA-N
XLogP3.45
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.37
LogP ≤ 53.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid?
The IUPAC name of 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid (CID 116965847) is 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid is CCCc1csc(C2CCC(C(=O)O)CC2)n1.
What is the InChIKey of 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid?
The InChIKey is RXUUCROJRDALQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2S/c1-2-3-11-8-17-12(14-11)9-4-6-10(7-5-9)13(15)16/h8-10H,2-7H2,1H3,(H,15,16).
What are the key properties of 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid?
4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid has a molecular weight of 253.37 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-propyl-1,3-thiazol-2-yl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 116965847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).