C17H27NO2S — CID 103485335
ethyl 3-[2-(4-propylcyclohexyl)-1,3-thiazol-4-yl]propanoate (PubChem CID 103485335) has the molecular formula C17H27NO2S and a molecular weight of 309.48 g/mol. Its IUPAC name is ethyl 3-[2-(4-propylcyclohexyl)-1,3-thiazol-4-yl]propanoate.
| Compound Name | ethyl 3-[2-(4-propylcyclohexyl)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 103485335 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | ethyl 3-[2-(4-propylcyclohexyl)-1,3-thiazol-4-yl]propanoate |
| SMILES | CCCC1CCC(c2nc(CCC(=O)OCC)cs2)CC1 |
| InChI | InChI=1S/C17H27NO2S/c1-3-5-13-6-8-14(9-7-13)17-18-15(12-21-17)10-11-16(19)20-4-2/h12-14H,3-11H2,1-2H3 |
| InChIKey | ROPVPGSKDZQUGA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |