2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid

C10H13NO2S — CID 60922034

IUPAC2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid
SMILESO=C(O)Cc1csc(C2CCCC2)n1
InChIInChI=1S/C10H13NO2S/c12-9(13)5-8-6-14-10(11-8)7-3-1-2-4-7/h6-7H,1-5H2,(H,12,13)
InChIKeyRELITADUORNXHA-UHFFFAOYSA-N
MW211.29 g/mol
LogP2.43
Rot. Bonds3

About 2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid

2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid (PubChem CID 60922034) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid
PubChem CID60922034
Molecular FormulaC10H13NO2S
Molecular Weight211.29 g/mol
Exact Mass211.07
IUPAC Name2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid
SMILESO=C(O)Cc1csc(C2CCCC2)n1
InChIInChI=1S/C10H13NO2S/c12-9(13)5-8-6-14-10(11-8)7-3-1-2-4-7/h6-7H,1-5H2,(H,12,13)
InChIKeyRELITADUORNXHA-UHFFFAOYSA-N
XLogP2.43
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.29
LogP ≤ 52.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone
CID 62367219
ethyl 2-(2-cyclooctyl-1,3-thiazol-4-yl)acetate
CID 80602146
2-[2-(3-ethylcyclopentyl)-1,3-thiazol-4-yl]acetic acid
CID 65409041
3-(2-cyclopentyl-1,3-thiazol-4-yl)-2-methylpropanoic acid
CID 116889289
ethyl 2-(2-cyclobutyl-1,3-thiazol-4-yl)acetate
CID 80573343
3-(2-cyclobutyl-1,3-thiazol-4-yl)-2,2-dimethylpropanoic acid
CID 116889315
2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid
CID 166253613
2-[2-(cyclopentylamino)-1,3-thiazol-4-yl]acetic acid
CID 9154876
4-(2-cyclobutyl-1,3-thiazol-4-yl)butan-2-one
CID 116890297
(2R)-1-[(2-cyclopentyl-1,3-thiazol-4-yl)methyl]pyrrolidine-2-carboxylic acid
CID 119913941
1-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxylic acid
CID 119908160
2-[2-[1-[(3-methyl-1,2-thiazol-5-yl)methyl]piperidin-4-yl]-1,3-thiazol-4-yl]acetic acid
CID 167935062

Frequently Asked Questions

What is the IUPAC name of 2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid?
The IUPAC name of 2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid (CID 60922034) is 2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid.
What is the SMILES notation for 2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid?
The canonical SMILES for 2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid is O=C(O)Cc1csc(C2CCCC2)n1.
What is the InChIKey of 2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid?
The InChIKey is RELITADUORNXHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c12-9(13)5-8-6-14-10(11-8)7-3-1-2-4-7/h6-7H,1-5H2,(H,12,13).
What are the key properties of 2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid?
2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid has a molecular weight of 211.29 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclopentyl-1,3-thiazol-4-yl)acetic acid is sourced from PubChem (CID 60922034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).