About 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone
2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone (PubChem CID 62367219) has the molecular formula C17H19NOS
and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone.
Molecular Properties
| Compound Name | 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone |
| PubChem CID | 62367219 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone |
| SMILES | O=C(Cc1csc(C2CCCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C17H19NOS/c19-16(13-7-3-1-4-8-13)11-15-12-20-17(18-15)14-9-5-2-6-10-14/h1,3-4,7-8,12,14H,2,5-6,9-11H2 |
| InChIKey | MEKNXCXULPIPCV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone?
The IUPAC name of 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone (CID 62367219) is 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone.
What is the SMILES notation for 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone?
The canonical SMILES for 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone is O=C(Cc1csc(C2CCCCC2)n1)c1ccccc1.
What is the InChIKey of 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone?
The InChIKey is MEKNXCXULPIPCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NOS/c19-16(13-7-3-1-4-8-13)11-15-12-20-17(18-15)14-9-5-2-6-10-14/h1,3-4,7-8,12,14H,2,5-6,9-11H2.
What are the key properties of 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone?
2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone has a molecular weight of 285.41 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclohexyl-1,3-thiazol-4-yl)-1-phenylethanone is sourced from PubChem (CID 62367219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).